Difference between revisions of "CPD-7196"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] == * smiles: ** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
+
** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
 
* common name:
 
* common name:
−
** TCA cycle III (animals)
+
** 9-cis-violaxanthin
 +
* inchi key:
 +
** InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N
 +
* molecular weight:
 +
** 600.88   
 
* Synonym(s):
 
* Synonym(s):
−
** tricarboxylic acid cycle
+
** 9-c-violaxanthin
−
** citric acid cycle
+
** 9cViol
−
** Szent-Gyorgyi-Krebs cycle
+
−
** Krebs cycle
+
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''10''' reaction(s) found
+
* [[RXN-7974]]
−
** [[RXN0-1147]]
+
== Reaction(s) known to produce the compound ==
−
** [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** [[CITSYN-RXN]]
+
−
** [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
+
−
** [[ACONITATEDEHYDR-RXN]]
+
−
** [[ACONITATEHYDR-RXN]]
+
−
** [[2OXOGLUTDECARB-RXN]]
+
−
** [[MALATE-DEH-RXN]]
+
−
** [[SUCCCOASYN-RXN]]
+
−
** [[FUMHYDR-RXN]]
+
−
== Reaction(s) not found ==
+
−
* '''1''' reaction(s) not found
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=ISOCITRATE-DEHYDROGENASE-NAD+-RXN ISOCITRATE-DEHYDROGENASE-NAD+-RXN]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33208}}
+
* PUBCHEM:
−
{{#set: common name=TCA cycle III (animals)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282218 5282218]
−
{{#set: common name=tricarboxylic acid cycle|citric acid cycle|Szent-Gyorgyi-Krebs cycle|Krebs cycle}}
+
* CHEBI:
−
{{#set: reaction found=10}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35305 35305]
−
{{#set: reaction not found=1}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C13433 C13433]
 +
{{#set: smiles=CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}}
 +
{{#set: common name=9-cis-violaxanthin}}
 +
{{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N}}
 +
{{#set: molecular weight=600.88    }}
 +
{{#set: common name=9-c-violaxanthin|9cViol}}
 +
{{#set: consumed by=RXN-7974}}

Latest revision as of 19:47, 21 March 2018

Metabolite CPD-7196

  • smiles:
    • CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
  • common name:
    • 9-cis-violaxanthin
  • inchi key:
    • InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N
  • molecular weight:
    • 600.88
  • Synonym(s):
    • 9-c-violaxanthin
    • 9cViol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-7196&oldid=43797"