Difference between revisions of "CPD-281"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] == * smiles: ** CC(C(SC(CCCCC(N)=O)CCS)=O)C * common name: ** S-(2-methylpropa...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] == |
* smiles: | * smiles: | ||
− | ** CC(C | + | ** CC(C(SC(CCCCC(N)=O)CCS)=O)C |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** S-(2-methylpropanoyl)-dihydrolipoamide |
+ | * inchi key: | ||
+ | ** InChIKey=XZUKURPVWDTXGE-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 277.439 |
* Synonym(s): | * Synonym(s): | ||
− | ** ( | + | ** S-(2-methylpropionyl)-dihydrolipoamide |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[DHRT_ibcoa]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440335 440335] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.389302.html 389302] |
− | {{#set: smiles=CC(C | + | {{#set: smiles=CC(C(SC(CCCCC(N)=O)CCS)=O)C}} |
− | {{#set: | + | {{#set: common name=S-(2-methylpropanoyl)-dihydrolipoamide}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=XZUKURPVWDTXGE-UHFFFAOYSA-N}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=277.439 }} |
− | {{#set: common name=( | + | {{#set: common name=S-(2-methylpropionyl)-dihydrolipoamide}} |
− | {{#set: | + | {{#set: consumed by=DHRT_ibcoa}} |
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite CPD-281
- smiles:
- CC(C(SC(CCCCC(N)=O)CCS)=O)C
- common name:
- S-(2-methylpropanoyl)-dihydrolipoamide
- inchi key:
- InChIKey=XZUKURPVWDTXGE-UHFFFAOYSA-N
- molecular weight:
- 277.439
- Synonym(s):
- S-(2-methylpropionyl)-dihydrolipoamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links