Difference between revisions of "Tiso gene 8027"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == * smiles: ** [CH](=O)CC([N+])C(=O)[O-] *...") |
(Created page with "Category:Gene == Gene Tiso_gene_8027 == * Synonym(s): == Reactions associated == * Reaction: 1.14.19.1-RXN ** Source: orthology-esiliculosus * Reaction: RXN-116...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8027 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[1.14.19.1-RXN]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Reaction: [[RXN-11680]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | + | * Reaction: [[RXN-12776]] | |
− | == | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-5353]] | ||
+ | * [[PWY-6603]] | ||
+ | * [[PWY-5996]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=1.14.19.1-RXN|RXN-11680|RXN-12776}} | |
− | + | {{#set: pathway associated=PWY-5353|PWY-6603|PWY-5996}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 19:48, 21 March 2018
Gene Tiso_gene_8027
- Synonym(s):
Reactions associated
- Reaction: 1.14.19.1-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-11680
- Source: orthology-esiliculosus
- Reaction: RXN-12776
- Source: orthology-esiliculosus