Difference between revisions of "CPD-16458"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10744 == * left end position: ** 62 * transcription direction: ** POSITIVE * right end position: ** 3991 * centisome position: ** 0.7444764...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * smiles: ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) * common name: ** 7,8-dihyd...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_10744 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] ==
* left end position:
+
* smiles:
** 62
+
** C2(=O)(C1(=C(NCC=N1)NC(=O)N2))
* transcription direction:
+
* common name:
** POSITIVE
+
** 7,8-dihydrolumazine
* right end position:
+
* inchi key:
** 3991
+
** InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N
* centisome position:
+
* molecular weight:
** 0.74447644    
+
** 166.139    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ADENYLATECYC-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-15261]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=62}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=590555 590555]
{{#set: right end position=3991}}
+
{{#set: smiles=C2(=O)(C1(=C(NCC=N1)NC(=O)N2))}}
{{#set: centisome position=0.74447644   }}
+
{{#set: common name=7,8-dihydrolumazine}}
{{#set: reaction associated=ADENYLATECYC-RXN}}
+
{{#set: inchi key=InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=166.139   }}
 +
{{#set: produced by=RXN-15261}}

Latest revision as of 19:48, 21 March 2018

Metabolite CPD-16458

  • smiles:
    • C2(=O)(C1(=C(NCC=N1)NC(=O)N2))
  • common name:
    • 7,8-dihydrolumazine
  • inchi key:
    • InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N
  • molecular weight:
    • 166.139
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links