Difference between revisions of "Tiso gene 14226"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14226 == * right end position: ** 9898 * transcription direction: ** NEGATIVE * left end position: ** 7775 * centisome position: ** 71.7581...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] ==
+
== Gene Tiso_gene_14226 ==
−
* smiles:
+
* right end position:
−
** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
+
** 9898
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** lotaustralin
+
** 7775
−
* molecular weight:
+
* centisome position:
−
** 261.274    
+
** 71.758194    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9674]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-13603]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=9898}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441467 441467]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=7775}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6542 6542]
+
{{#set: centisome position=71.758194   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08334 C08334]
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
* HMDB : HMDB33865
+
−
{{#set: smiles=CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C}}
+
−
{{#set: inchi key=InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N}}
+
−
{{#set: common name=lotaustralin}}
+
−
{{#set: molecular weight=261.274   }}
+
−
{{#set: common name=2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside}}
+
−
{{#set: consumed by=RXN-9674}}
+
−
{{#set: produced by=RXN-13603}}
+

Latest revision as of 19:48, 21 March 2018

Gene Tiso_gene_14226

  • right end position:
    • 9898
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 7775
  • centisome position:
    • 71.758194
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14226&oldid=43921"