Difference between revisions of "CPD1F-118"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-118 CPD1F-118] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CCCC1(C)C)C))C)C)C=CC=C(C=CC2(...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-118 CPD1F-118] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CCCC1(C)C)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** α-carotene |
| + | * inchi key: | ||
| + | ** InChIKey=ANVAOWXLWRTKGA-JLTXGRSLSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 536.882 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-5961]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1F-148]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * LIPID_MAPS : LMPR01070258 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4369188 4369188] |
| + | * HMDB : HMDB03993 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05433 C05433] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.3571861.html 3571861] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28425 28425] |
| − | {{#set: smiles= | + | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(=C(CCCC1(C)C)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C}} |
| − | {{#set: | + | {{#set: common name=α-carotene}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ANVAOWXLWRTKGA-JLTXGRSLSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=536.882 }} |
| − | + | {{#set: consumed by=RXN-5961}} | |
| − | {{#set: consumed by=RXN- | + | {{#set: produced by=RXN1F-148}} |
| − | {{#set: produced by= | + | |
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite CPD1F-118
- smiles:
- CC(=CC=CC=C(C=CC=C(C=CC1(=C(CCCC1(C)C)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C
- common name:
- α-carotene
- inchi key:
- InChIKey=ANVAOWXLWRTKGA-JLTXGRSLSA-N
- molecular weight:
- 536.882
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPR01070258
- PUBCHEM:
- HMDB : HMDB03993
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
