Difference between revisions of "Tiso gene 15758"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))...")
 
(Created page with "Category:Gene == Gene Tiso_gene_15758 == * Synonym(s): == Reactions associated == * Reaction: HDS ** Source: orthology-creinhardtii * Reaction: RXN0-882 ** So...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] ==
+
== Gene Tiso_gene_15758 ==
* smiles:
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
* inchi key:
+
** InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M
+
* common name:
+
** gibberellin A51
+
* molecular weight:
+
** 331.388   
+
 
* Synonym(s):
 
* Synonym(s):
** GA51
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[HDS]]
* [[RXN-171]]
+
** Source: [[orthology-creinhardtii]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN0-882]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7560]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170022
+
{{#set: reaction associated=HDS|RXN0-882}}
* PUBCHEM:
+
{{#set: pathway associated=PWY-7560}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245666 25245666]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29599 29599]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11865 C11865]
+
* HMDB : HMDB35041
+
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M}}
+
{{#set: common name=gibberellin A51}}
+
{{#set: molecular weight=331.388    }}
+
{{#set: common name=GA51}}
+
{{#set: produced by=RXN-171}}
+

Latest revision as of 19:04, 21 March 2018

Gene Tiso_gene_15758

  • Synonym(s):

Reactions associated

Pathways associated

External links