Difference between revisions of "CPD-14443"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3961 PWY-3961] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * common name: ** (2S,4...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) |
* common name: | * common name: | ||
| − | ** | + | ** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate |
| + | * inchi key: | ||
| + | ** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L | ||
| + | * molecular weight: | ||
| + | ** 185.136 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-14014]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[DIHYDRODIPICSYN-RXN]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139] |
| + | {{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}} | ||
| + | {{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}} | ||
| + | {{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}} | ||
| + | {{#set: molecular weight=185.136 }} | ||
| + | {{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}} | ||
| + | {{#set: consumed by=RXN-14014}} | ||
| + | {{#set: produced by=DIHYDRODIPICSYN-RXN}} | ||
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite CPD-14443
- smiles:
- C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
- common name:
- (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
- inchi key:
- InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
- molecular weight:
- 185.136
- Synonym(s):
- (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)" cannot be used as a page name in this wiki.
