Difference between revisions of "D-MYO-INOSITOL-13-BISPHOSPHATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5367 PWY-5367] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-13-BISPHOSPHATE D-MYO-INOSITOL-13-BISPHOSPHATE] == * smiles: ** C1(O)(C(O)C(OP([...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-13-BISPHOSPHATE D-MYO-INOSITOL-13-BISPHOSPHATE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C1(O)(C(O)C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(O)1) |
* common name: | * common name: | ||
− | ** | + | ** D-myo-inositol (1,3)-bisphosphate |
+ | * inchi key: | ||
+ | ** InChIKey=PUVHMWJJTITUGO-FICORBCRSA-J | ||
+ | * molecular weight: | ||
+ | ** 336.085 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1D-myo-inositol (1,3)-bisphosphate |
+ | ** myo-inositol (1,3)-bisphosphate | ||
+ | ** inositol (1,3)-bisphosphate | ||
+ | ** Ins(1,3)P2 | ||
+ | ** I(1,3)P2 | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10959]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 103597-56-4 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201139 25201139] |
− | {{#set: | + | * HMDB : HMDB06234 |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83242 83242] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04062 C04062] | ||
+ | {{#set: smiles=C1(O)(C(O)C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(O)1)}} | ||
+ | {{#set: common name=D-myo-inositol (1,3)-bisphosphate}} | ||
+ | {{#set: inchi key=InChIKey=PUVHMWJJTITUGO-FICORBCRSA-J}} | ||
+ | {{#set: molecular weight=336.085 }} | ||
+ | {{#set: common name=1D-myo-inositol (1,3)-bisphosphate|myo-inositol (1,3)-bisphosphate|inositol (1,3)-bisphosphate|Ins(1,3)P2|I(1,3)P2}} | ||
+ | {{#set: produced by=RXN-10959}} |
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite D-MYO-INOSITOL-13-BISPHOSPHATE
- smiles:
- C1(O)(C(O)C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(O)1)
- common name:
- D-myo-inositol (1,3)-bisphosphate
- inchi key:
- InChIKey=PUVHMWJJTITUGO-FICORBCRSA-J
- molecular weight:
- 336.085
- Synonym(s):
- 1D-myo-inositol (1,3)-bisphosphate
- myo-inositol (1,3)-bisphosphate
- inositol (1,3)-bisphosphate
- Ins(1,3)P2
- I(1,3)P2
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(O)1)" cannot be used as a page name in this wiki.