Difference between revisions of "CPD0-341"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-742 RXN0-742] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/6....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] == * smiles: ** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS * common name: ** S-succ...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-742 RXN0-742] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/6.3.4.18 EC-6.3.4.18]
+
** S-succinyl-dihydrolipoamide
 +
* inchi key:
 +
** InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M
 +
* molecular weight:
 +
** 306.414   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE]][c] '''+''' 1 [[HCO3]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[CPD0-181]][c] '''+''' 2 [[PROTON]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[AKGDHe2r]]
−
** 1 5-amino-1-(5-phospho-β-D-ribosyl)imidazole[c] '''+''' 1 hydrogencarbonate[c] '''+''' 1 ATP[c] '''=>''' 1 phosphate[c] '''+''' 1 ADP[c] '''+''' 1 N5-carboxyaminoimidazole ribonucleotide[c] '''+''' 2 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_16011]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
== Pathways  ==
+
−
* [[PWY-6123]], inosine-5'-phosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6123 PWY-6123]
+
−
** '''5''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-7234]], inosine-5'-phosphate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7234 PWY-7234]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19317 19317]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657579 90657579]
−
* LIGAND-RXN:
+
* HMDB : HMDB01177
−
** [http://www.genome.jp/dbget-bin/www_bget?R07404 R07404]
+
* CHEBI:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17432 17432]
−
{{#set: ec number=EC-6.3.4.18}}
+
* LIGAND-CPD:
−
{{#set: gene associated=Tiso_gene_16011}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01169 C01169]
−
{{#set: in pathway=PWY-6123|PWY-7234}}
+
{{#set: smiles=C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=S-succinyl-dihydrolipoamide}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M}}
−
{{#set: reconstruction source=synechocystis}}
+
{{#set: molecular weight=306.414    }}
 +
{{#set: reversible reaction associated=AKGDHe2r}}

Latest revision as of 19:50, 21 March 2018

Metabolite CPD0-341

  • smiles:
    • C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS
  • common name:
    • S-succinyl-dihydrolipoamide
  • inchi key:
    • InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M
  • molecular weight:
    • 306.414
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD0-341&oldid=44053"