Difference between revisions of "Tiso gene 12634"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] == * smiles: ** C1(=C(C=C(O)C(O)=C1)C2(OC3(C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_12634 == * right end position: ** 6725 * transcription direction: ** NEGATIVE * left end position: ** 3993 * centisome position: ** 58.6343...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] ==
+
== Gene Tiso_gene_12634 ==
−
* smiles:
+
* right end position:
−
** C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))
+
** 6725
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** luteolin
+
** 3993
−
* molecular weight:
+
* centisome position:
−
** 285.232    
+
** 58.634357    
 
* Synonym(s):
 
* Synonym(s):
−
** 3',4',5,7-tetrahydroxyflavone
 
−
** 5,7,3',4'-tetrahydroxyflavone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[HISTIDINE--TRNA-LIGASE-RXN]]
−
* [[RXN-15291]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-7651]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* CAS : 491-70-3
+
{{#set: right end position=6725}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201972 25201972]
+
{{#set: left end position=3993}}
−
* CHEBI:
+
{{#set: centisome position=58.634357   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57545 57545]
+
{{#set: reaction associated=HISTIDINE--TRNA-LIGASE-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01514 C01514]
+
−
* HMDB : HMDB05800
+
−
{{#set: smiles=C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))}}
+
−
{{#set: inchi key=InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M}}
+
−
{{#set: common name=luteolin}}
+
−
{{#set: molecular weight=285.232   }}
+
−
{{#set: common name=3',4',5,7-tetrahydroxyflavone|5,7,3',4'-tetrahydroxyflavone}}
+
−
{{#set: produced by=RXN-15291|RXN-7651}}
+

Latest revision as of 19:50, 21 March 2018

Gene Tiso_gene_12634

  • right end position:
    • 6725
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3993
  • centisome position:
    • 58.634357
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12634&oldid=44104"