Difference between revisions of "CPD-10267"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12221 == * left end position: ** 2731 * transcription direction: ** POSITIVE * right end position: ** 4337 * centisome position: ** 37.8621...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] == * smiles: ** CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * common name: |
| − | ** | + | ** decanoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=CNKJPHSEFDPYDB-HSJNEKGZSA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 917.754 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-13615]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-13614]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | * [[RXN-14274]] |
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : dcacoa |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244140 25244140] |
| − | {{#set: | + | * HMDB : HMDB06404 |
| − | {{#set: reaction associated= | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05274 C05274] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61430 61430] | ||
| + | * METABOLIGHTS : MTBLC61430 | ||
| + | {{#set: smiles=CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: common name=decanoyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=CNKJPHSEFDPYDB-HSJNEKGZSA-J}} | ||
| + | {{#set: molecular weight=917.754 }} | ||
| + | {{#set: consumed by=RXN-13615}} | ||
| + | {{#set: produced by=RXN-13614}} | ||
| + | {{#set: reversible reaction associated=RXN-14274}} | ||
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite CPD-10267
- smiles:
- CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- decanoyl-CoA
- inchi key:
- InChIKey=CNKJPHSEFDPYDB-HSJNEKGZSA-J
- molecular weight:
- 917.754
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : dcacoa
- PUBCHEM:
- HMDB : HMDB06404
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC61430
"CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
