Difference between revisions of "Tiso gene 13231"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13231 == * right end position: ** 6246 * transcription direction: ** POSITIVE * left end position: ** 5584 * centisome position: ** 86.7484...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] ==
+
== Gene Tiso_gene_13231 ==
−
* smiles:
+
* right end position:
−
** [CH](=O)C(C(C(C(CO)O)O)O)O
+
** 6246
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** aldehydo-D-galactose
+
** 5584
−
* molecular weight:
+
* centisome position:
−
** 180.157    
+
** 86.74849    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-14409]]
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-16425]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16426]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-5514]]
 +
* [[PWY-6906]]
 +
* [[UDPNACETYLGALSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=6246}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01582 C01582]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=5584}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17118 17118]
+
{{#set: centisome position=86.74849    }}
−
* PUBCHEM:
+
{{#set: reaction associated=PHOSACETYLGLUCOSAMINEMUT-RXN|RXN-16425|RXN-16426}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3037556 3037556]
+
{{#set: pathway associated=PWY-5514|PWY-6906|UDPNACETYLGALSYN-PWY}}
−
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
+
−
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N}}
+
−
{{#set: common name=aldehydo-D-galactose}}
+
−
{{#set: molecular weight=180.157    }}
+
−
{{#set: consumed or produced by=RXN-14409}}
+

Latest revision as of 19:51, 21 March 2018

Gene Tiso_gene_13231

  • right end position:
    • 6246
  • transcription direction:
    • POSITIVE
  • left end position:
    • 5584
  • centisome position:
    • 86.74849
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13231&oldid=44157"