Difference between revisions of "CPD-15590"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9247 CPD-9247] == * smiles: ** CCCCCCC=CCCCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=UWHZIFQ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * common name: ** aldehydo-D-ga...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == |
* smiles: | * smiles: | ||
− | ** | + | ** [CH](=O)C(C(C(C(CO)O)O)O)O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** aldehydo-D-galactose |
+ | * inchi key: | ||
+ | ** InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14409]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01582 C01582] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17118 17118] |
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3037556 3037556] |
− | {{#set: | + | {{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}} |
− | {{#set: molecular weight= | + | {{#set: common name=aldehydo-D-galactose}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N}} |
− | + | {{#set: molecular weight=180.157 }} | |
+ | {{#set: reversible reaction associated=RXN-14409}} |
Latest revision as of 20:51, 21 March 2018
Contents
Metabolite CPD-15590
- smiles:
- [CH](=O)C(C(C(C(CO)O)O)O)O
- common name:
- aldehydo-D-galactose
- inchi key:
- InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(C(C(C(CO)O)O)O)O" cannot be used as a page name in this wiki.