Difference between revisions of "CPD-7015"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEAMINE-DIOXYGENASE-RXN CYSTEAMINE-DIOXYGENASE-RXN] == * direction: ** LEFT-TO-RIGHT * common na...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEAMINE-DIOXYGENASE-RXN CYSTEAMINE-DIOXYGENASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
 
* common name:
 
* common name:
** 2-aminoethanethiol_dioxygenase
+
** 71-hydroxychlorophyllide a
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.13.11.19 EC-1.13.11.19]
+
** 628.966   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-hydroxychlorophyllide a (misleading)
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-7677]]
** 1 [[CPD-239]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[HYPOTAURINE]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-7676]]
** 1 cysteamine[c] '''+''' 1 oxygen[c] '''=>''' 1 hypotaurine[c] '''+''' 1 H+[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_9748]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWY-5331]], taurine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5331 PWY-5331]
+
** '''2''' reactions found over '''4''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[esiliculosus]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14409 14409]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657206 90657206]
* LIGAND-RXN:
+
* LIGAND-CPD:
** [http://www.genome.jp/dbget-bin/www_bget?R02467 R02467]
+
** [http://www.genome.jp/dbget-bin/www_bget?C16540 C16540]
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
{{#set: common name=2-aminoethanethiol_dioxygenase}}
+
{{#set: common name=71-hydroxychlorophyllide a}}
{{#set: ec number=EC-1.13.11.19}}
+
{{#set: molecular weight=628.966    }}
{{#set: gene associated=Tiso_gene_9748}}
+
{{#set: common name=7-hydroxychlorophyllide a (misleading)}}
{{#set: in pathway=PWY-5331}}
+
{{#set: consumed by=RXN-7677}}
{{#set: reconstruction category=orthology}}
+
{{#set: produced by=RXN-7676}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=esiliculosus}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 20:51, 21 March 2018

Metabolite CPD-7015

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • 71-hydroxychlorophyllide a
  • molecular weight:
    • 628.966
  • Synonym(s):
    • 7-hydroxychlorophyllide a (misleading)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.