Difference between revisions of "Tiso gene 13074"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDRO-3-DEOXY-D-GLUCONATE 2-DEHYDRO-3-DEOXY-D-GLUCONATE] == * smiles: ** C(=O)([O-])C(=O)CC...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13074 == * right end position: ** 4501 * transcription direction: ** POSITIVE * left end position: ** 2848 * centisome position: ** 43.4610...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDRO-3-DEOXY-D-GLUCONATE 2-DEHYDRO-3-DEOXY-D-GLUCONATE] ==
+
== Gene Tiso_gene_13074 ==
−
* smiles:
+
* right end position:
−
** C(=O)([O-])C(=O)CC(O)C(O)CO
+
** 4501
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 2-dehydro-3-deoxy-D-gluconate
+
** 2848
−
* molecular weight:
+
* centisome position:
−
** 177.133    
+
** 43.46101    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-keto-3-deoxy-D-gluconic acid
 
−
** 2-keto-3-deoxy-D-gluconate
 
−
** 3-deoxy-2-oxo-D-gluconate
 
−
** 2-keto-3-deoxygluconate
 
−
** 3-deoxy-D-erythro-hex-2-ulosonic acid
 
−
** KDG
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.4.21.4-RXN]]
−
* [[MANNONDEHYDRAT-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-17832]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7797]]
 
== External links  ==
 
== External links  ==
−
* CAS : 17510-99-5
+
{{#set: right end position=4501}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229111 44229111]
+
{{#set: left end position=2848}}
−
* HMDB : HMDB01353
+
{{#set: centisome position=43.46101   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.4.21.4-RXN|RXN-17832}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00204 C00204]
+
{{#set: pathway associated=PWY-7797}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57990 57990]
+
−
* BIGG : 2ddglcn
+
−
{{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)CO}}
+
−
{{#set: inchi key=InChIKey=WPAMZTWLKIDIOP-WVZVXSGGSA-M}}
+
−
{{#set: common name=2-dehydro-3-deoxy-D-gluconate}}
+
−
{{#set: molecular weight=177.133   }}
+
−
{{#set: common name=2-keto-3-deoxy-D-gluconic acid|2-keto-3-deoxy-D-gluconate|3-deoxy-2-oxo-D-gluconate|2-keto-3-deoxygluconate|3-deoxy-D-erythro-hex-2-ulosonic acid|KDG}}
+
−
{{#set: produced by=MANNONDEHYDRAT-RXN}}
+

Latest revision as of 19:51, 21 March 2018

Gene Tiso_gene_13074

  • right end position:
    • 4501
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2848
  • centisome position:
    • 43.46101
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13074&oldid=44220"