Difference between revisions of "CPD0-1081"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SELENOHOMOCYSTEINE SELENOHOMOCYSTEINE] == * smiles: ** C(C[Se])C([N+])C(=O)[O-] * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] == * smiles: ** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate |
+ | * inchi key: | ||
+ | ** InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 477.444 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** glcNAc-1,6-anhMurNAc |
+ | ** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-5226]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658409 90658409] |
− | * | + | * BIGG : anhgm |
− | {{#set: smiles= | + | {{#set: smiles=CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))}} |
− | {{#set: | + | {{#set: common name=N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=477.444 }} |
− | {{#set: common name= | + | {{#set: common name=glcNAc-1,6-anhMurNAc|N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid}} |
− | {{#set: | + | {{#set: consumed by=RXN0-5226}} |
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite CPD0-1081
- smiles:
- CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))
- common name:
- N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate
- inchi key:
- InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M
- molecular weight:
- 477.444
- Synonym(s):
- glcNAc-1,6-anhMurNAc
- N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- BIGG : anhgm
"CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))" cannot be used as a page name in this wiki.