Difference between revisions of "Beta-Lactams"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2747 CPD-2747] == * smiles: ** C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-Lactams Beta-Lactams] == * common name: ** a β-lactam * Synonym(s): == Reaction(s) k...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2747 CPD-2747] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-Lactams Beta-Lactams] ==
* smiles:
+
** C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
+
* inchi key:
+
** InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N
+
 
* common name:
 
* common name:
** cotinine-glucuronide
+
** a β-lactam
* molecular weight:
+
** 352.343   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[BETA-LACTAMASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-168]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a β-lactam}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820250 91820250]
+
{{#set: consumed by=BETA-LACTAMASE-RXN}}
* HMDB : HMDB01013
+
{{#set: smiles=C1(=O)(CC[CH](N(C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
+
{{#set: inchi key=InChIKey=XWZCZWKUGIQPJD-CVRQRIFOSA-N}}
+
{{#set: common name=cotinine-glucuronide}}
+
{{#set: molecular weight=352.343    }}
+
{{#set: produced by=RXN66-168}}
+

Latest revision as of 19:52, 21 March 2018

Metabolite Beta-Lactams

  • common name:
    • a β-lactam
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links