Difference between revisions of "RXN-4303"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IDP IDP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4303 RXN-4303] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IDP IDP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4303 RXN-4303] ==
* smiles:
+
* direction:
** C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=JPXZQMKKFWMMGK-KQYNXXCUSA-K
+
** [http://enzyme.expasy.org/EC/2.5.1.112 EC-2.5.1.112]
* common name:
+
** IDP
+
* molecular weight:
+
** 425.165   
+
 
* Synonym(s):
 
* Synonym(s):
** riboxin
 
** inosine diphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[ATIDm]]
+
* With identifiers:
* [[RXN-14003]]
+
** 1 [[ATP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-4211]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-4201]][c]
* [[ATID]]
+
* With common name(s):
== Reaction(s) known to produce the compound ==
+
** 1 ATP[c] '''+''' 1 H+[c] '''+''' 1 dimethylallyl diphosphate[c] '''=>''' 1 diphosphate[c] '''+''' 1 N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate[c]
* [[RXN0-5073]]
+
 
* [[ITUP]]
+
== Genes associated with this reaction  ==
* [[ITCY]]
+
Genes have been associated with this reaction based on different elements listed below.
== Reaction(s) of unknown directionality ==
+
* Gene: [[Tiso_gene_3274]]
* [[RXN-14120]]
+
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-2681]], trans-zeatin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2681 PWY-2681]
 +
** '''2''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 86-04-4
+
* LIGAND-RXN:
* METABOLIGHTS : MTBLC58280
+
** [http://www.genome.jp/dbget-bin/www_bget?R08051 R08051]
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7156952 7156952]
+
{{#set: ec number=EC-2.5.1.112}}
* HMDB : HMDB03335
+
{{#set: gene associated=Tiso_gene_3274}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-2681}}
** [http://www.genome.jp/dbget-bin/www_bget?C00104 C00104]
+
{{#set: reconstruction category=orthology}}
* CHEMSPIDER:
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
** [http://www.chemspider.com/Chemical-Structure.3279691.html 3279691]
+
{{#set: reconstruction tool=pantograph}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58280 58280]
+
* BIGG : idp
+
{{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
{{#set: inchi key=InChIKey=JPXZQMKKFWMMGK-KQYNXXCUSA-K}}
+
{{#set: common name=IDP}}
+
{{#set: molecular weight=425.165    }}
+
{{#set: common name=riboxin|inosine diphosphate}}
+
{{#set: consumed by=ATIDm|RXN-14003|ATID}}
+
{{#set: produced by=RXN0-5073|ITUP|ITCY}}
+
{{#set: consumed or produced by=RXN-14120}}
+

Latest revision as of 19:52, 21 March 2018

Reaction RXN-4303

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 H+[c] + 1 dimethylallyl diphosphate[c] => 1 diphosphate[c] + 1 N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2681, trans-zeatin biosynthesis: PWY-2681
    • 2 reactions found over 11 reactions in the full pathway

Reconstruction information

External links