Difference between revisions of "RXN1G-2544"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP(OP([O-])([O-])=O)([O-])=O *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2544 RXN1G-2544] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-cyclopropane-Δ1...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2544 RXN1G-2544] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.1.1.79 EC-2.1.1.79] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[cis-D19-37-MOH-38-Me-C57-1-ACPs]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[cis-19-CP-37-Mex-38-Me-C59-ACPs]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] | |
| − | + | * With common name(s): | |
| − | + | ** 1 a cis-delta19-37-methoxy-38-methyl-C57:1-[acp][c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 a cis-methoxy-C59-meroacyl-[acp][c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c] | |
| − | + | ||
| − | + | == Genes associated with this reaction == | |
| − | + | Genes have been associated with this reaction based on different elements listed below. | |
| − | * [[ | + | * Gene: [[Tiso_gene_7622]] |
| − | + | ** Source: [[orthology-esiliculosus]] | |
| − | * [[ | + | == Pathways == |
| − | * [[ | + | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] |
| − | * [[ | + | ** '''86''' reactions found over '''182''' reactions in the full pathway |
| − | + | == Reconstruction information == | |
| − | * [[ | + | * Category: [[orthology]] |
| − | * [[ | + | ** Source: [[orthology-esiliculosus]] |
| − | * [[ | + | *** Tool: [[pantograph]] |
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase}} | |
| − | + | {{#set: ec number=EC-2.1.1.79}} | |
| − | + | {{#set: gene associated=Tiso_gene_7622}} | |
| − | + | {{#set: in pathway=PWYG-321}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:52, 21 March 2018
Contents
Reaction RXN1G-2544
- direction:
- LEFT-TO-RIGHT
- common name:
- cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 cis-D19-37-MOH-38-Me-C57-1-ACPs[c] + 1 S-ADENOSYLMETHIONINE[c] => 1 cis-19-CP-37-Mex-38-Me-C59-ACPs[c] + 1 ADENOSYL-HOMO-CYS[c] + 1 PROTON[c]
- With common name(s):
- 1 a cis-delta19-37-methoxy-38-methyl-C57:1-[acp][c] + 1 S-adenosyl-L-methionine[c] => 1 a cis-methoxy-C59-meroacyl-[acp][c] + 1 S-adenosyl-L-homocysteine[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_7622
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
"cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase" cannot be used as a page name in this wiki.
