Difference between revisions of "GLYCERALDEHYDE-DEHYDRO-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * inchi key: ** InChIKey=ZBCBET...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCERALDEHYDE-DEHYDRO-RXN GLYCERALDEHYDE-DEHYDRO-RXN] == * direction: ** LEFT-TO-RIGHT * ec number...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCERALDEHYDE-DEHYDRO-RXN GLYCERALDEHYDE-DEHYDRO-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.2.99.8 EC-1.2.99.8] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[Acceptor]][c] '''+''' 1 [[GLYCERALD]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Donor-H2]][c] '''+''' 1 [[GLYCERATE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 an oxidized electron acceptor[c] '''+''' 1 D-glyceraldehyde[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 a reduced electron acceptor[c] '''+''' 1 D-glycerate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_7322]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[NPGLUCAT-PWY]], Entner-Doudoroff pathway II (non-phosphorylative): [http://metacyc.org/META/NEW-IMAGE?object=NPGLUCAT-PWY NPGLUCAT-PWY] | ||
+ | ** '''4''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30783 30783] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01752 R01752] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: ec number=EC-1.2.99.8}} |
− | * LIGAND- | + | {{#set: gene associated=Tiso_gene_7322}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=NPGLUCAT-PWY}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:52, 21 March 2018
Contents
Reaction GLYCERALDEHYDE-DEHYDRO-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 an oxidized electron acceptor[c] + 1 D-glyceraldehyde[c] + 1 H2O[c] => 1 H+[c] + 1 a reduced electron acceptor[c] + 1 D-glycerate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_7322
- Source: orthology-esiliculosus
Pathways
- NPGLUCAT-PWY, Entner-Doudoroff pathway II (non-phosphorylative): NPGLUCAT-PWY
- 4 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links