Difference between revisions of "TROPATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11381 == * left end position: ** 10463 * transcription direction: ** POSITIVE * right end position: ** 13023 * centisome position: ** 79.97...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPATE TROPATE] == * smiles: ** C(O)C(C1(C=CC=CC=1))C([O-])=O * common name: ** tropate * inch...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPATE TROPATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C(C1(C=CC=CC=1))C([O-])=O |
| − | * | + | * common name: |
| − | ** | + | ** tropate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JACRWUWPXAESPB-UHFFFAOYSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 165.168 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[TROPINESTERASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460086 5460086] |
| − | {{#set: | + | * CAS : 529-64-6 |
| − | {{#set: | + | * NCI: |
| − | {{#set: | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=20990 20990] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01456 C01456] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4573754.html 4573754] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17000 17000] | ||
| + | {{#set: smiles=C(O)C(C1(C=CC=CC=1))C([O-])=O}} | ||
| + | {{#set: common name=tropate}} | ||
| + | {{#set: inchi key=InChIKey=JACRWUWPXAESPB-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=165.168 }} | ||
| + | {{#set: produced by=TROPINESTERASE-RXN}} | ||
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite TROPATE
- smiles:
- C(O)C(C1(C=CC=CC=1))C([O-])=O
- common name:
- tropate
- inchi key:
- InChIKey=JACRWUWPXAESPB-UHFFFAOYSA-M
- molecular weight:
- 165.168
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(C1(C=CC=CC=1))C([O-])=O" cannot be used as a page name in this wiki.
