Difference between revisions of "RXN0-1342"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] == * smiles: ** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1342 RXN0-1342] == * direction: ** LEFT-TO-RIGHT * common name: ** s-adenosylmethionine_trna_r...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1342 RXN0-1342] ==
* smiles:
+
* direction:
** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M
+
 
* common name:
 
* common name:
** (25R)-3α,7α-dihydroxy-5-β-cholestanate
+
** s-adenosylmethionine_trna_ribosyltransferase
* molecular weight:
+
* ec number:
** 433.65   
+
** [http://enzyme.expasy.org/EC/2.4.99.17 EC-2.4.99.17]
 
* Synonym(s):
 
* Synonym(s):
** 3-α,7-α-dihydroxy-5-β-cholestanoate
 
** 3-α,7-α-dihydroxy-5-β-cholestanate
 
** (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-9844]]
+
** 1 [[tRNA-with-7-aminomethyl-7-deazaguanine]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[MET]][c] '''+''' 1 [[tRNAs-containing-epoxy-quenosine]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADENINE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a 7-aminomethyl-7-deazaguanosine34 in tRNA[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 L-methionine[c] '''+''' 1 an epoxyqueuosine34 in tRNA[c] '''+''' 1 H+[c] '''+''' 1 adenine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6037]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6700]], queuosine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6700 PWY-6700]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266753 45266753]
+
{{#set: common name=s-adenosylmethionine_trna_ribosyltransferase}}
* CHEBI:
+
{{#set: ec number=EC-2.4.99.17}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58750 58750]
+
{{#set: gene associated=Tiso_gene_6037}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6700}}
** [http://www.genome.jp/dbget-bin/www_bget?C04554 C04554]
+
{{#set: reconstruction category=annotation}}
{{#set: smiles=CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: inchi key=InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=(25R)-3α,7α-dihydroxy-5-β-cholestanate}}
+
{{#set: molecular weight=433.65    }}
+
{{#set: common name=3-α,7-α-dihydroxy-5-β-cholestanoate|3-α,7-α-dihydroxy-5-β-cholestanate|(25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate}}
+
{{#set: produced by=RXN-9844}}
+

Latest revision as of 19:53, 21 March 2018

Reaction RXN0-1342

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • s-adenosylmethionine_trna_ribosyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6700, queuosine biosynthesis: PWY-6700
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links