Difference between revisions of "BFFS"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BFFS BFFS] == * direction: ** LEFT-TO-RIGHT * common name: ** beta-fructofuranosidase * Synonym(s):...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BFFS BFFS] ==
* smiles:
+
* direction:
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N
+
 
* common name:
 
* common name:
** 6-deoxotyphasterol
+
** beta-fructofuranosidase
* molecular weight:
+
** 434.701   
+
 
* Synonym(s):
 
* Synonym(s):
** deoxotyphasterol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-4241]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[SUCROSE-6P]][c] '''=>''' 1.0 [[ALPHA-GLC-6-P]][c] '''+''' 1.0 [[BETA-D-FRUCTOSE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H2O[c] '''+''' 1.0 sucrose 6F-phosphate[c] '''=>''' 1.0 α-D-glucose 6-phosphate[c] '''+''' 1.0 β-D-fructofuranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1006]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_1580]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061346 16061346]
+
{{#set: common name=beta-fructofuranosidase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_1006|Tiso_gene_1580}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20717 20717]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C15801 C15801]
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N}}
+
{{#set: common name=6-deoxotyphasterol}}
+
{{#set: molecular weight=434.701    }}
+
{{#set: common name=deoxotyphasterol}}
+
{{#set: consumed by=RXN-4241}}
+

Latest revision as of 19:53, 21 March 2018

Reaction BFFS

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • beta-fructofuranosidase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 sucrose 6F-phosphate[c] => 1.0 α-D-glucose 6-phosphate[c] + 1.0 β-D-fructofuranose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links