Difference between revisions of "CPD-1834"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_7378 == * Synonym(s): == Reactions associated == * RXN-982 ** pantograph-esiliculosus == Pathways associated == * PWY-4621...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] == * smiles: ** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_7378 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] ==
 +
* smiles:
 +
** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
 +
* common name:
 +
** (25R)-3α,7α-dihydroxy-5-β-cholestanate
 +
* inchi key:
 +
** InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M
 +
* molecular weight:
 +
** 433.65   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-α,7-α-dihydroxy-5-β-cholestanoate
 +
** 3-α,7-α-dihydroxy-5-β-cholestanate
 +
** (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-982]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-9844]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-4621]]
+
* [[PWY-4202]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-982}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-4621|PWY-4202}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266753 45266753]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58750 58750]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C04554 C04554]
 +
{{#set: smiles=CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))}}
 +
{{#set: common name=(25R)-3α,7α-dihydroxy-5-β-cholestanate}}
 +
{{#set: inchi key=InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M}}
 +
{{#set: molecular weight=433.65    }}
 +
{{#set: common name=3-α,7-α-dihydroxy-5-β-cholestanoate|3-α,7-α-dihydroxy-5-β-cholestanate|(25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate}}
 +
{{#set: produced by=RXN-9844}}

Latest revision as of 19:53, 21 March 2018

Metabolite CPD-1834

  • smiles:
    • CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
  • common name:
    • (25R)-3α,7α-dihydroxy-5-β-cholestanate
  • inchi key:
    • InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M
  • molecular weight:
    • 433.65
  • Synonym(s):
    • 3-α,7-α-dihydroxy-5-β-cholestanoate
    • 3-α,7-α-dihydroxy-5-β-cholestanate
    • (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))" cannot be used as a page name in this wiki.