Difference between revisions of "CPD-720"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1342 RXN0-1342] == * direction: ** LEFT-TO-RIGHT * common name: ** s-adenosylmethionine_trna_r...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1342 RXN0-1342] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** s-adenosylmethionine_trna_ribosyltransferase
+
** 6-deoxotyphasterol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.4.99.17 EC-2.4.99.17]
+
** InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N
 +
* molecular weight:
 +
** 434.701   
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxotyphasterol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-4241]]
−
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[tRNA-with-7-aminomethyl-7-deazaguanine]][c] '''=>''' 1 [[MET]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADENINE]][c] '''+''' 1 [[tRNAs-containing-epoxy-quenosine]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 S-adenosyl-L-methionine[c] '''+''' 1 a 7-aminomethyl-7-deazaguanosine34 in tRNA[c] '''=>''' 1 L-methionine[c] '''+''' 1 H+[c] '''+''' 1 adenine[c] '''+''' 1 an epoxyqueuosine34 in tRNA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_6037]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-6700]], queuosine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6700 PWY-6700]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=s-adenosylmethionine_trna_ribosyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061346 16061346]
−
{{#set: ec number=EC-2.4.99.17}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_6037}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20717 20717]
−
{{#set: in pathway=PWY-6700}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15801 C15801]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=6-deoxotyphasterol}}
 +
{{#set: inchi key=InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N}}
 +
{{#set: molecular weight=434.701    }}
 +
{{#set: common name=deoxotyphasterol}}
 +
{{#set: consumed by=RXN-4241}}

Latest revision as of 19:53, 21 March 2018

Metabolite CPD-720

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 6-deoxotyphasterol
  • inchi key:
    • InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N
  • molecular weight:
    • 434.701
  • Synonym(s):
    • deoxotyphasterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-720&oldid=44402"