Difference between revisions of "FPGPL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] == * smiles: ** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPGPL FPGPL] == * direction: ** REVERSIBLE * common name: ** D-Fructose 1-phosphate D-glyceraldehyd...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPGPL FPGPL] ==
* smiles:
+
* direction:
** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
* inchi key:
+
** InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J
+
 
* common name:
 
* common name:
** 3-hydroxy-5-methylhex-4-enoyl-CoA
+
** D-Fructose 1-phosphate D-glyceraldehyde-3-phosphate-lyase
* molecular weight:
+
** 889.657   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-11919]]
+
** 1.0 [[D-fructofuranose-1-phosphate]][h] '''<=>''' 1.0 [[GLYCERALD]][h] '''+''' 1.0 [[DIHYDROXY-ACETONE-PHOSPHATE]][h]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 D-fructofuranose 1-phosphate[h] '''<=>''' 1.0 D-glyceraldehyde[h] '''+''' 1.0 glycerone phosphate[h]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_65]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986102 50986102]
+
{{#set: common name=D-Fructose 1-phosphate D-glyceraldehyde-3-phosphate-lyase}}
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_65}}
** [http://www.genome.jp/dbget-bin/www_bget?C16469 C16469]
+
{{#set: in pathway=}}
* HMDB : HMDB60373
+
{{#set: reconstruction category=orthology}}
{{#set: smiles=CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: inchi key=InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=3-hydroxy-5-methylhex-4-enoyl-CoA}}
+
{{#set: molecular weight=889.657    }}
+
{{#set: produced by=RXN-11919}}
+

Latest revision as of 19:53, 21 March 2018

Reaction FPGPL

  • direction:
    • REVERSIBLE
  • common name:
    • D-Fructose 1-phosphate D-glyceraldehyde-3-phosphate-lyase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links