Difference between revisions of "Tiso gene 6822"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_6822 == * Synonym(s): == Reactions associated == * Reaction: ATPASE-RXN ** Source: annotation-in-silico_annotation *** Assignment:...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] ==
+
== Gene Tiso_gene_6822 ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
* inchi key:
+
** InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J
+
* common name:
+
** sinapoyl-CoA
+
* molecular weight:
+
** 969.7   
+
 
* Synonym(s):
 
* Synonym(s):
** sinapinoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
* [[RXN-10919]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
* [[RXN-1124]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=ATPASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229225 44229225]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57393 57393]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00411 C00411]
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J}}
+
{{#set: common name=sinapoyl-CoA}}
+
{{#set: molecular weight=969.7    }}
+
{{#set: common name=sinapinoyl-CoA}}
+
{{#set: produced by=RXN-10919}}
+
{{#set: consumed or produced by=RXN-1124}}
+

Latest revision as of 19:54, 21 March 2018

Gene Tiso_gene_6822

  • Synonym(s):

Reactions associated

Pathways associated

External links