Difference between revisions of "Tiso gene 3418"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3418 == * right end position: ** 10700 * transcription direction: ** POSITIVE * left end position: ** 2779 * centisome position: ** 16.6138...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] ==
+
== Gene Tiso_gene_3418 ==
−
* smiles:
+
* right end position:
−
** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
+
** 10700
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 5'-hydroxycotinine
+
** 2779
−
* molecular weight:
+
* centisome position:
−
** 192.217    
+
** 16.613857    
 
* Synonym(s):
 
* Synonym(s):
−
** allohydroxycotinine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-15556]]
−
* [[RXN66-163]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=10700}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9815515 9815515]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=2779}}
−
** [http://www.chemspider.com/Chemical-Structure.7991265.html 7991265]
+
{{#set: centisome position=16.613857   }}
−
* HMDB : HMDB01427
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}}
+
−
{{#set: common name=5'-hydroxycotinine}}
+
−
{{#set: molecular weight=192.217   }}
+
−
{{#set: common name=allohydroxycotinine}}
+
−
{{#set: produced by=RXN66-163}}
+

Latest revision as of 20:54, 21 March 2018

Gene Tiso_gene_3418

  • right end position:
    • 10700
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2779
  • centisome position:
    • 16.613857
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3418&oldid=44501"