Difference between revisions of "CPD-2751"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PMPOXI-RXN PMPOXI-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** pyridoxamine_5_-phosphate...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * common name: ** 5'-hydr...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PMPOXI-RXN PMPOXI-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
 
* common name:
 
* common name:
−
** pyridoxamine_5_-phosphate_oxidase-related_fmn-binding
+
** 5'-hydroxycotinine
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.4.3.5 EC-1.4.3.5]
+
** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
 +
* molecular weight:
 +
** 192.217   
 
* Synonym(s):
 
* Synonym(s):
 +
** allohydroxycotinine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PYRIDOXAMINE-5P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[PYRIDOXAL_PHOSPHATE]][c]
+
* [[RXN66-163]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 oxygen[c] '''+''' 1 pyridoxamine 5'-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 ammonium[c] '''+''' 1 hydrogen peroxide[c] '''+''' 1 pyridoxal 5'-phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_1471]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7204]], pyridoxal 5'-phosphate salvage II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PLPSAL-PWY]], pyridoxal 5'-phosphate salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PLPSAL-PWY PLPSAL-PWY]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15817 15817]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9815515 9815515]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00277 R00277]
+
** [http://www.chemspider.com/Chemical-Structure.7991265.html 7991265]
−
* UNIPROT:
+
* HMDB : HMDB01427
−
** [http://www.uniprot.org/uniprot/P0AFI7 P0AFI7]
+
{{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}}
−
** [http://www.uniprot.org/uniprot/Q9JTZ1 Q9JTZ1]
+
{{#set: common name=5'-hydroxycotinine}}
−
** [http://www.uniprot.org/uniprot/P44909 P44909]
+
{{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}}
−
** [http://www.uniprot.org/uniprot/P38075 P38075]
+
{{#set: molecular weight=192.217    }}
−
** [http://www.uniprot.org/uniprot/P74211 P74211]
+
{{#set: common name=allohydroxycotinine}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: produced by=RXN66-163}}
−
{{#set: common name=pyridoxamine_5_-phosphate_oxidase-related_fmn-binding}}
+
−
{{#set: ec number=EC-1.4.3.5}}
+
−
{{#set: gene associated=Tiso_gene_1471}}
+
−
{{#set: in pathway=PWY-7204|PLPSAL-PWY}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=esiliculosus}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 19:54, 21 March 2018

Metabolite CPD-2751

  • smiles:
    • C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
  • common name:
    • 5'-hydroxycotinine
  • inchi key:
    • InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
  • molecular weight:
    • 192.217
  • Synonym(s):
    • allohydroxycotinine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-2751&oldid=44510"