Difference between revisions of "RXN-11501"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] == * smiles: ** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11501 RXN-11501] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha-galactosidase * ec nu...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11501 RXN-11501] ==
−
* smiles:
+
* direction:
−
** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K
+
 
* common name:
 
* common name:
−
** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate
+
** alpha-galactosidase
−
* molecular weight:
+
* ec number:
−
** 380.17   
+
** [http://enzyme.expasy.org/EC/3.2.1.22 EC-3.2.1.22]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-15733]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-170]][c] '''=>''' 1 [[ALPHA-D-GALACTOSE]][c] '''+''' 1 [[CPD-1099]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 stachyose[c] '''=>''' 1 α-D-galactose[c] '''+''' 1 raffinose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16101]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_4615]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_8673]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_3392]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-6527]], stachyose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527]
 +
** '''7''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657876 90657876]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03634 R03634]
−
{{#set: smiles=CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K}}
+
{{#set: common name=alpha-galactosidase}}
−
{{#set: common name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate}}
+
{{#set: ec number=EC-3.2.1.22}}
−
{{#set: molecular weight=380.17    }}
+
{{#set: gene associated=Tiso_gene_16101|Tiso_gene_4615|Tiso_gene_8673|Tiso_gene_3392}}
−
{{#set: produced by=RXN-15733}}
+
{{#set: in pathway=PWY-6527}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-athaliana|orthology-creinhardtii|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:54, 21 March 2018

Reaction RXN-11501

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • alpha-galactosidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6527, stachyose degradation: PWY-6527
    • 7 reactions found over 7 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-11501&oldid=44525"