Difference between revisions of "CPD1F-4"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10658 RXN-10658] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == * smiles: ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) * com...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10658 RXN-10658] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)
 
* common name:
 
* common name:
−
** 3-oxoacyl-synthase
+
** (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
** InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N
 +
* molecular weight:
 +
** 382.542   
 
* Synonym(s):
 
* Synonym(s):
 +
** C25-allenic-apo-aldehyde
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Cis-Delta7-tetradecenoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''=>''' 1 [[3-oxo-cis-D9-hexadecenoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACP]][c]
+
* [[RXN-698]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a cis-Δ7-tetradecenoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''=>''' 1 a 3-oxo-cis-Δ9-hexadecenoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 a holo-[acyl-carrier protein][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_19302]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_5939]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_14485]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_15991]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-oxoacyl-synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245424 25245424]
−
{{#set: ec number=EC-2.3.1.41}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_19302|Tiso_gene_5939|Tiso_gene_14485|Tiso_gene_15991}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34596 34596]
−
{{#set: in pathway=PWY-6282}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C14044 C14044]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: common name=(3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=382.542    }}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: common name=C25-allenic-apo-aldehyde}}
 +
{{#set: produced by=RXN-698}}

Latest revision as of 20:54, 21 March 2018

Metabolite CPD1F-4

  • smiles:
    • CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)
  • common name:
    • (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
  • inchi key:
    • InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N
  • molecular weight:
    • 382.542
  • Synonym(s):
    • C25-allenic-apo-aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1F-4&oldid=44536"