Difference between revisions of "RXN-11195"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-420 CPD-420] == * smiles: ** CC(NC(C(=O)[O-])CC(=O)[O-])=O * inchi key: ** InChIKey=OTCCIMW...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11195 RXN-11195] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF ** cytochrome_b5_reduct...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11195 RXN-11195] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** ORF |
| − | * | + | ** cytochrome_b5_reductase |
| − | ** | + | ** nadh-cytochrome_b5reductase |
| + | * ec number: | ||
| + | ** [http://enzyme.expasy.org/EC/1.6.2.2 EC-1.6.2.2] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1 [[NADH]][c] '''+''' 2 [[Ferrihemoglobins]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[PROTON]][c] '''+''' 2 [[Ferrohemoglobins]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1 NADH[c] '''+''' 2 a ferrihemoglobin[c] '''=>''' 1 NAD+[c] '''+''' 1 H+[c] '''+''' 2 a ferrohemoglobin[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_7152]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | * Gene: [[Tiso_gene_8773]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | * Gene: [[Tiso_gene_19905]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_6189]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=ORF}} | |
| − | + | {{#set: common name=cytochrome_b5_reductase}} | |
| − | + | {{#set: common name=nadh-cytochrome_b5reductase}} | |
| − | + | {{#set: ec number=EC-1.6.2.2}} | |
| − | + | {{#set: gene associated=Tiso_gene_7152|Tiso_gene_8773|Tiso_gene_19905|Tiso_gene_6189}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:54, 21 March 2018
Contents
Reaction RXN-11195
- direction:
- LEFT-TO-RIGHT
- common name:
- ORF
- cytochrome_b5_reductase
- nadh-cytochrome_b5reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADH[c] + 2 Ferrihemoglobins[c] => 1 NAD[c] + 1 PROTON[c] + 2 Ferrohemoglobins[c]
- With common name(s):
- 1 NADH[c] + 2 a ferrihemoglobin[c] => 1 NAD+[c] + 1 H+[c] + 2 a ferrohemoglobin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_7152
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_8773
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_19905
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_6189
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
