Difference between revisions of "Tiso gene 11613"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] == * smiles: ** C(OP(=O)([O-])...")
 
(Created page with "Category:Gene == Gene Tiso_gene_11613 == * right end position: ** 4962 * transcription direction: ** NEGATIVE * left end position: ** 2554 * centisome position: ** 33.2725...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] ==
+
== Gene Tiso_gene_11613 ==
−
* smiles:
+
* right end position:
−
** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2))
+
** 4962
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PMFMJXPRNJUYMB-GWOFURMSSA-K
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** N-(5-phosphoribosyl)-anthranilate
+
** 2554
−
* molecular weight:
+
* centisome position:
−
** 346.21    
+
** 33.272537    
 
* Synonym(s):
 
* Synonym(s):
−
** N-(5-phospho-D-ribosyl)-anthranilate
 
−
** N-(5-phospho-β-D-ribosyl)-anthranilate
 
−
** 5-phosphoribosyl-anthranilate
 
−
** 5-P-ribosyl-anthranilate
 
−
** 5'-phosphoribosyl-anthranilate
 
−
** 5'-P-ribosyl-anthranilate
 
−
** N-(5-phosphoribosyl)-anthranilate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[PRAISOM-RXN]]
+
* Reaction: [[3.1.13.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[PRTRANS-RXN]]
+
* Reaction: [[RXN0-4222]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-6479]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-6524]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-6525]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY0-1479]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4962}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548600 9548600]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=2554}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18277 18277]
+
{{#set: centisome position=33.272537   }}
−
* BIGG : pran
+
{{#set: reaction associated=3.1.13.1-RXN|RXN0-4222|RXN0-6479|RXN0-6524|RXN0-6525}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY0-1479}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04302 C04302]
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)NC2(C=CC=CC(C(=O)[O-])=2))}}
+
−
{{#set: inchi key=InChIKey=PMFMJXPRNJUYMB-GWOFURMSSA-K}}
+
−
{{#set: common name=N-(5-phosphoribosyl)-anthranilate}}
+
−
{{#set: molecular weight=346.21   }}
+
−
{{#set: common name=N-(5-phospho-D-ribosyl)-anthranilate|N-(5-phospho-β-D-ribosyl)-anthranilate|5-phosphoribosyl-anthranilate|5-P-ribosyl-anthranilate|5'-phosphoribosyl-anthranilate|5'-P-ribosyl-anthranilate|N-(5-phosphoribosyl)-anthranilate}}
+
−
{{#set: consumed by=PRAISOM-RXN}}
+
−
{{#set: consumed or produced by=PRTRANS-RXN}}
+

Latest revision as of 19:54, 21 March 2018

Gene Tiso_gene_11613

  • right end position:
    • 4962
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 2554
  • centisome position:
    • 33.272537
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11613&oldid=44577"