Difference between revisions of "CPD-19160"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11919 RXN-11919] == * direction: ** LEFT-TO-RIGHT * common name: ** (2E)-5-methylhexa-2,4-dieno...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11919 RXN-11919] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
** (2E)-5-methylhexa-2,4-dienoyl-CoA hydratase
+
** 3-oxo-(11Z)-octadecenoyl-CoA
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/4.2.1 EC-4.2.1]
+
** InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
 +
* molecular weight:
 +
** 1041.936   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-18:1-Δ11-CoA
 +
** 3-oxo-11-cis-octadecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17787]]
** 1 [[CPD-12904]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-12905]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17786]]
** 1 (2E)-5-methylhexa-2,4-dienoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 3-hydroxy-5-methylhex-4-enoyl-CoA[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_14257]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWY-6672]], cis-genanyl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6672 PWY-6672]
+
** '''4''' reactions found over '''9''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
** [http://www.genome.jp/dbget-bin/www_bget?R08093 R08093]
+
{{#set: common name=3-oxo-(11Z)-octadecenoyl-CoA}}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J}}
{{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA hydratase}}
+
{{#set: molecular weight=1041.936    }}
{{#set: ec number=EC-4.2.1}}
+
{{#set: common name=3-oxo-18:1-Δ11-CoA|3-oxo-11-cis-octadecenoyl-CoA}}
{{#set: gene associated=Tiso_gene_14257}}
+
{{#set: consumed by=RXN-17787}}
{{#set: in pathway=PWY-6672}}
+
{{#set: produced by=RXN-17786}}
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=esiliculosus}}
+

Latest revision as of 20:09, 21 March 2018

Metabolite CPD-19160

  • smiles:
    • CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 3-oxo-(11Z)-octadecenoyl-CoA
  • inchi key:
    • InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
  • molecular weight:
    • 1041.936
  • Synonym(s):
    • 3-oxo-18:1-Δ11-CoA
    • 3-oxo-11-cis-octadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.