Difference between revisions of "3.4.11.2-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9924 CPD-9924] == * smiles: ** C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-]) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.11.2-RXN 3.4.11.2-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** aminopeptidase_n ** m...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.11.2-RXN 3.4.11.2-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** aminopeptidase_n |
− | * | + | ** membrane_aminopeptidase_i |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/3.4.11.2 EC-3.4.11.2] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[POLYPEPTIDE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[L-Amino-Acids]][c] '''+''' 1 [[POLYPEPTIDE]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 a polypeptide[c] '''+''' 1 H2O[c] '''=>''' 1 an L-amino acid[c] '''+''' 1 a polypeptide[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_860]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_16906]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P15144 P15144] |
− | * | + | ** [http://www.uniprot.org/uniprot/P15684 P15684] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P15145 P15145] |
− | * | + | ** [http://www.uniprot.org/uniprot/P04825 P04825] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P45274 P45274] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9JTU7 Q9JTU7] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q10730 Q10730] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P15541 P15541] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P37897 P37897] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P37896 P37896] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=aminopeptidase_n}} |
+ | {{#set: common name=membrane_aminopeptidase_i}} | ||
+ | {{#set: ec number=EC-3.4.11.2}} | ||
+ | {{#set: gene associated=Tiso_gene_860|Tiso_gene_16906}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:55, 21 March 2018
Contents
Reaction 3.4.11.2-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- aminopeptidase_n
- membrane_aminopeptidase_i
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 POLYPEPTIDE[c] + 1 WATER[c] => 1 L-Amino-Acids[c] + 1 POLYPEPTIDE[c]
- With common name(s):
- 1 a polypeptide[c] + 1 H2O[c] => 1 an L-amino acid[c] + 1 a polypeptide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_860
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_16906
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links