Difference between revisions of "CPD-9924"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCMP-DEAMINASE-RXN DCMP-DEAMINASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enz...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9924 CPD-9924] == * smiles: ** C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-]) *...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9924 CPD-9924] == |
− | * | + | * smiles: |
− | ** | + | ** C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-]) |
− | * | + | * common name: |
− | ** | + | ** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate |
+ | * inchi key: | ||
+ | ** InChIKey=JKJGLRGLOMRXFN-MVWJERBFSA-K | ||
+ | * molecular weight: | ||
+ | ** 325.251 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** SEPHCHC | ||
+ | ** 5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-9310]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.5.1.64-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657446 90657446] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50271 50271] |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16519 C16519] | |
− | + | {{#set: smiles=C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-])}} | |
− | * | + | {{#set: common name=2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=JKJGLRGLOMRXFN-MVWJERBFSA-K}} |
− | + | {{#set: molecular weight=325.251 }} | |
− | {{#set: | + | {{#set: common name=SEPHCHC|5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylate}} |
− | {{#set: | + | {{#set: consumed by=RXN-9310}} |
− | {{#set: | + | {{#set: produced by=2.5.1.64-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite CPD-9924
- smiles:
- C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-])
- common name:
- 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate
- inchi key:
- InChIKey=JKJGLRGLOMRXFN-MVWJERBFSA-K
- molecular weight:
- 325.251
- Synonym(s):
- SEPHCHC
- 5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-])" cannot be used as a page name in this wiki.