Difference between revisions of "Tiso gene 4677"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * smiles: ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Tiso_gene_4677 == * right end position: ** 9450 * transcription direction: ** POSITIVE * left end position: ** 3255 * centisome position: ** 22.36191...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4677 == |
− | * | + | * right end position: |
− | ** | + | ** 9450 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3255 |
− | * | + | * centisome position: |
− | ** | + | ** 22.361914 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PRPPSYN-RXN]] | |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[R5PDP]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[RPDPK]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY0-662]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=9450}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3255}} | |
− | + | {{#set: centisome position=22.361914 }} | |
− | + | {{#set: reaction associated=PRPPSYN-RXN|R5PDP|RPDPK}} | |
− | + | {{#set: pathway associated=PWY0-662}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:56, 21 March 2018
Gene Tiso_gene_4677
- right end position:
- 9450
- transcription direction:
- POSITIVE
- left end position:
- 3255
- centisome position:
- 22.361914
- Synonym(s):
Reactions associated
- Reaction: PRPPSYN-RXN
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
- Reaction: R5PDP
- Source: orthology-creinhardtii
- Reaction: RPDPK
- Source: orthology-creinhardtii