Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-1-P"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5194 == * left end position: ** 181 * transcription direction: ** POSITIVE * right end position: ** 1013 * centisome position: ** 1.3120697...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * smiles: ** CC(=O)NC1(C(O)C(O)C(CO)O...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1) |
− | * | + | * common name: |
− | ** | + | ** N-acetyl-α-D-glucosamine 1-phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 299.174 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[NAG1P-URIDYLTRANS-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-16426]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04256 C04256] |
− | {{#set: | + | * HMDB : HMDB01367 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57776 57776] |
− | {{#set: | + | * BIGG : acgam1p |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243937 25243937] | ||
+ | {{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)}} | ||
+ | {{#set: common name=N-acetyl-α-D-glucosamine 1-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L}} | ||
+ | {{#set: molecular weight=299.174 }} | ||
+ | {{#set: consumed by=NAG1P-URIDYLTRANS-RXN}} | ||
+ | {{#set: produced by=RXN-16426}} | ||
+ | {{#set: reversible reaction associated=PHOSACETYLGLUCOSAMINEMUT-RXN}} |
Latest revision as of 20:56, 21 March 2018
Contents
Metabolite N-ACETYL-D-GLUCOSAMINE-1-P
- smiles:
- CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)
- common name:
- N-acetyl-α-D-glucosamine 1-phosphate
- inchi key:
- InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L
- molecular weight:
- 299.174
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.