Difference between revisions of "CPD-8620"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9235 RXN-9235] == * direction: ** LEFT-TO-RIGHT * common name: ** ubiquinone_biosynthesis_methy...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9235 RXN-9235] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
 
* common name:
 
* common name:
−
** ubiquinone_biosynthesis_methyltransferase
+
** 5α-cholesta-8-en-3-one
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.1.1.201 EC-2.1.1.201]
+
** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
 +
* molecular weight:
 +
** 384.644   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-9869]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-9871]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
+
* [[RXN66-23]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 H+[c] '''+''' 1 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol[c] '''+''' 1 S-adenosyl-L-homocysteine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_19352]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5872]], ubiquinol-10 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5872 PWY-5872]
+
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-5857]], ubiquinol-10 biosynthesis (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5857 PWY-5857]
+
−
** '''1''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ubiquinone_biosynthesis_methyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263324 44263324]
−
{{#set: ec number=EC-2.1.1.201}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_19352}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87056 87056]
−
{{#set: in pathway=PWY-5872|PWY-5857}}
+
* HMDB : HMDB12178
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=5α-cholesta-8-en-3-one}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}}
 +
{{#set: molecular weight=384.644    }}
 +
{{#set: produced by=RXN66-23}}

Latest revision as of 19:56, 21 March 2018

Metabolite CPD-8620

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
  • common name:
    • 5α-cholesta-8-en-3-one
  • inchi key:
    • InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
  • molecular weight:
    • 384.644
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8620&oldid=44804"