Difference between revisions of "HISTAMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glycosylated-sugar-Acceptors Non-Glycosylated-sugar-Acceptors] == * common name: ** a non g...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE HISTAMINE] == * smiles: ** C1(=C(NC=N1)CC[N+]) * common name: ** histamine * inchi ke...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE HISTAMINE] == |
+ | * smiles: | ||
+ | ** C1(=C(NC=N1)CC[N+]) | ||
* common name: | * common name: | ||
− | ** | + | ** histamine |
+ | * inchi key: | ||
+ | ** InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O | ||
+ | * molecular weight: | ||
+ | ** 112.154 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** peremin |
+ | ** 1H-Imidazole-4-ethanamine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9600]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 51-45-6 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201573 25201573] |
+ | * HMDB : HMDB00870 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00388 C00388] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58432 58432] | ||
+ | * METABOLIGHTS : MTBLC58432 | ||
+ | {{#set: smiles=C1(=C(NC=N1)CC[N+])}} | ||
+ | {{#set: common name=histamine}} | ||
+ | {{#set: inchi key=InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O}} | ||
+ | {{#set: molecular weight=112.154 }} | ||
+ | {{#set: common name=peremin|1H-Imidazole-4-ethanamine}} | ||
+ | {{#set: consumed by=RXN-9600}} |
Latest revision as of 20:57, 21 March 2018
Contents
Metabolite HISTAMINE
- smiles:
- C1(=C(NC=N1)CC[N+])
- common name:
- histamine
- inchi key:
- InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O
- molecular weight:
- 112.154
- Synonym(s):
- peremin
- 1H-Imidazole-4-ethanamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 51-45-6
- PUBCHEM:
- HMDB : HMDB00870
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58432
"C1(=C(NC=N1)CC[N+])" cannot be used as a page name in this wiki.