Difference between revisions of "Tiso gene 19107"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Gene == Gene Tiso_gene_19107 == * right end position: ** 2235 * transcription direction: ** POSITIVE * left end position: ** 1092 * centisome position: ** 42.4242...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19107 == |
− | * | + | * right end position: |
− | ** | + | ** 2235 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1092 |
− | * | + | * centisome position: |
− | ** | + | ** 42.424244 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CHLORIDE-PEROXIDASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: right end position=2235}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1092}} | |
− | + | {{#set: centisome position=42.424244 }} | |
− | + | {{#set: reaction associated=CHLORIDE-PEROXIDASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:57, 21 March 2018
Gene Tiso_gene_19107
- right end position:
- 2235
- transcription direction:
- POSITIVE
- left end position:
- 1092
- centisome position:
- 42.424244
- Synonym(s):
Reactions associated
- Reaction: CHLORIDE-PEROXIDASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation