Difference between revisions of "CPD-1825"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10851 RXN-10851] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * smiles: ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * common name: ** β...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10851 RXN-10851] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)
 +
* common name:
 +
** β-L-arabinose 1-phosphate
 +
* inchi key:
 +
** InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** β-L-arabinose 1-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[UMPU]]
−
** 1 [[Donor-H2]][c] '''+''' 2 [[CPD-11281]][c] '''<=>''' 1 [[CPD-11763]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[HS]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a reduced electron acceptor[c] '''+''' 2 S-sulfanylglutathione[c] '''<=>''' 1 bisorganyltrisulfane[c] '''+''' 1 an oxidized electron acceptor[c] '''+''' 1 hydrogen sulfide[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-5294]], superpathway of sulfide oxidation (Acidithiobacillus ferrooxidans): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5294 PWY-5294]
+
−
** '''2''' reactions found over '''12''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-5294}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244737 25244737]
−
{{#set: reconstruction category=annotation}}
+
* HMDB : HMDB12195
−
{{#set: reconstruction tool=pathwaytools}}
+
* CHEBI:
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57521 57521]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03906 C03906]
 +
{{#set: smiles=C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)}}
 +
{{#set: common name=&beta;-L-arabinose 1-phosphate}}
 +
{{#set: inchi key=InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L}}
 +
{{#set: molecular weight=228.095    }}
 +
{{#set: common name=&beta;-L-arabinose 1-P}}
 +
{{#set: consumed by=UMPU}}

Latest revision as of 19:57, 21 March 2018

Metabolite CPD-1825

  • smiles:
    • C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)
  • common name:
    • β-L-arabinose 1-phosphate
  • inchi key:
    • InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L
  • molecular weight:
    • 228.095
  • Synonym(s):
    • β-L-arabinose 1-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-1825&oldid=44911"