Difference between revisions of "Tiso gene 9885"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * smiles: ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_9885 == * right end position: ** 5301 * transcription direction: ** POSITIVE * left end position: ** 3882 * centisome position: ** 43.14292...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9885 == |
− | * | + | * right end position: |
− | ** | + | ** 5301 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3882 |
− | * | + | * centisome position: |
− | ** | + | ** 43.14292 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.3.1.41-RXN]] |
− | + | ** Source: [[annotation-experimental_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[3-OXOACYL-ACP-REDUCT-RXN]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[PYRIDOXAL-4-DEHYDROGENASE-RXN]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-10060]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-10655]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-10659]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-11476]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-11480]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-12994]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-13008]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-13443]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16616]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16622]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16626]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16630]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9514]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9518]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9524]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9528]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9532]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9536]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9540]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9552]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9556]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9633]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN0-2142]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN1G-157]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN1G-349]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN1G-469]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN1G-508]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7388]] | ||
+ | * [[PWY-5367]] | ||
+ | * [[PWY-5973]] | ||
+ | * [[PWY-5971]] | ||
+ | * [[PWY-5499]] | ||
+ | * [[PWY0-862]] | ||
+ | * [[PWY-7053]] | ||
+ | * [[PWY-6113]] | ||
+ | * [[PWY-7619]] | ||
+ | * [[PWY-6282]] | ||
+ | * [[PWY-5994]] | ||
+ | * [[PWY3O-355]] | ||
+ | * [[PWY-7724]] | ||
+ | * [[PWY-7727]] | ||
+ | * [[FASYN-ELONG-PWY]] | ||
+ | * [[PWY-6519]] | ||
+ | * [[PWY-7602]] | ||
+ | * [[PWY-7606]] | ||
+ | * [[PWY-5989]] | ||
+ | * [[PWYG-321]] | ||
+ | * [[PWY-7663]] | ||
+ | * [[PWY-7664]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5301}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3882}} | |
− | + | {{#set: centisome position=43.14292 }} | |
− | + | {{#set: reaction associated=2.3.1.41-RXN|3-OXOACYL-ACP-REDUCT-RXN|PYRIDOXAL-4-DEHYDROGENASE-RXN|RXN-10060|RXN-10655|RXN-10659|RXN-11476|RXN-11480|RXN-12994|RXN-13008|RXN-13443|RXN-16616|RXN-16622|RXN-16626|RXN-16630|RXN-9514|RXN-9518|RXN-9524|RXN-9528|RXN-9532|RXN-9536|RXN-9540|RXN-9552|RXN-9556|RXN-9633|RXN0-2142|RXN1G-157|RXN1G-349|RXN1G-469|RXN1G-508}} | |
− | + | {{#set: pathway associated=PWY-7388|PWY-5367|PWY-5973|PWY-5971|PWY-5499|PWY0-862|PWY-7053|PWY-6113|PWY-7619|PWY-6282|PWY-5994|PWY3O-355|PWY-7724|PWY-7727|FASYN-ELONG-PWY|PWY-6519|PWY-7602|PWY-7606|PWY-5989|PWYG-321|PWY-7663|PWY-7664}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:57, 21 March 2018
Gene Tiso_gene_9885
- right end position:
- 5301
- transcription direction:
- POSITIVE
- left end position:
- 3882
- centisome position:
- 43.14292
- Synonym(s):
Reactions associated
- Reaction: 2.3.1.41-RXN
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Reaction: 3-OXOACYL-ACP-REDUCT-RXN
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: PYRIDOXAL-4-DEHYDROGENASE-RXN
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Reaction: RXN-10060
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-10655
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-10659
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-11476
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-11480
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-12994
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Reaction: RXN-13008
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-13443
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Reaction: RXN-16616
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-16622
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-16626
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-16630
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-9514
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-9518
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-9524
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-9528
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-9532
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-9536
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-9540
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-9552
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-9556
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN-9633
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN0-2142
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN1G-157
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN1G-349
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN1G-469
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Reaction: RXN1G-508
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
Pathways associated
- PWY-7388
- PWY-5367
- PWY-5973
- PWY-5971
- PWY-5499
- PWY0-862
- PWY-7053
- PWY-6113
- PWY-7619
- PWY-6282
- PWY-5994
- PWY3O-355
- PWY-7724
- PWY-7727
- FASYN-ELONG-PWY
- PWY-6519
- PWY-7602
- PWY-7606
- PWY-5989
- PWYG-321
- PWY-7663
- PWY-7664