Difference between revisions of "Tiso gene 9885"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * smiles: ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9885 == * right end position: ** 5301 * transcription direction: ** POSITIVE * left end position: ** 3882 * centisome position: ** 43.14292...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] ==
+
== Gene Tiso_gene_9885 ==
−
* smiles:
+
* right end position:
−
** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)
+
** 5301
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** β-L-arabinose 1-phosphate
+
** 3882
−
* molecular weight:
+
* centisome position:
−
** 228.095    
+
** 43.14292    
 
* Synonym(s):
 
* Synonym(s):
−
** β-L-arabinose 1-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[UMPU]]
+
* Reaction: [[2.3.1.41-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[3-OXOACYL-ACP-REDUCT-RXN]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[PYRIDOXAL-4-DEHYDROGENASE-RXN]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-10060]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10655]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10659]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-11476]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-11480]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12994]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-13008]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13443]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16616]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16622]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16626]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16630]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9514]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9518]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9524]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9528]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9532]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9536]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9540]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9552]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9556]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9633]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-2142]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN1G-157]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN1G-349]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN1G-469]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN1G-508]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7388]]
 +
* [[PWY-5367]]
 +
* [[PWY-5973]]
 +
* [[PWY-5971]]
 +
* [[PWY-5499]]
 +
* [[PWY0-862]]
 +
* [[PWY-7053]]
 +
* [[PWY-6113]]
 +
* [[PWY-7619]]
 +
* [[PWY-6282]]
 +
* [[PWY-5994]]
 +
* [[PWY3O-355]]
 +
* [[PWY-7724]]
 +
* [[PWY-7727]]
 +
* [[FASYN-ELONG-PWY]]
 +
* [[PWY-6519]]
 +
* [[PWY-7602]]
 +
* [[PWY-7606]]
 +
* [[PWY-5989]]
 +
* [[PWYG-321]]
 +
* [[PWY-7663]]
 +
* [[PWY-7664]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=5301}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244737 25244737]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=3882}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57521 57521]
+
{{#set: centisome position=43.14292   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.3.1.41-RXN|3-OXOACYL-ACP-REDUCT-RXN|PYRIDOXAL-4-DEHYDROGENASE-RXN|RXN-10060|RXN-10655|RXN-10659|RXN-11476|RXN-11480|RXN-12994|RXN-13008|RXN-13443|RXN-16616|RXN-16622|RXN-16626|RXN-16630|RXN-9514|RXN-9518|RXN-9524|RXN-9528|RXN-9532|RXN-9536|RXN-9540|RXN-9552|RXN-9556|RXN-9633|RXN0-2142|RXN1G-157|RXN1G-349|RXN1G-469|RXN1G-508}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03906 C03906]
+
{{#set: pathway associated=PWY-7388|PWY-5367|PWY-5973|PWY-5971|PWY-5499|PWY0-862|PWY-7053|PWY-6113|PWY-7619|PWY-6282|PWY-5994|PWY3O-355|PWY-7724|PWY-7727|FASYN-ELONG-PWY|PWY-6519|PWY-7602|PWY-7606|PWY-5989|PWYG-321|PWY-7663|PWY-7664}}
−
* HMDB : HMDB12195
+
−
{{#set: smiles=C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L}}
+
−
{{#set: common name=β-L-arabinose 1-phosphate}}
+
−
{{#set: molecular weight=228.095   }}
+
−
{{#set: common name=β-L-arabinose 1-P}}
+
−
{{#set: consumed by=UMPU}}
+

Latest revision as of 19:57, 21 March 2018

Gene Tiso_gene_9885

  • right end position:
    • 5301
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3882
  • centisome position:
    • 43.14292
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9885&oldid=44912"