Difference between revisions of "Tiso gene 20412"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SEROTONIN SEROTONIN] == * smiles: ** C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_20412 == * right end position: ** 325 * transcription direction: ** POSITIVE * left end position: ** 2 * centisome position: ** 0.14430015...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_20412 == |
− | * | + | * right end position: |
− | ** | + | ** 325 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2 |
− | * | + | * centisome position: |
− | ** | + | ** 0.14430015 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[6PGLUCONOLACT-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[P122-PWY]] | ||
+ | * [[RUMP-PWY]] | ||
+ | * [[OXIDATIVEPENT-PWY]] | ||
+ | * [[GLYCOLYSIS-E-D]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=325}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2}} | |
− | + | {{#set: centisome position=0.14430015 }} | |
− | + | {{#set: reaction associated=6PGLUCONOLACT-RXN}} | |
− | + | {{#set: pathway associated=P122-PWY|RUMP-PWY|OXIDATIVEPENT-PWY|GLYCOLYSIS-E-D}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:57, 21 March 2018
Gene Tiso_gene_20412
- right end position:
- 325
- transcription direction:
- POSITIVE
- left end position:
- 2
- centisome position:
- 0.14430015
- Synonym(s):
Reactions associated
- Reaction: 6PGLUCONOLACT-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation