Difference between revisions of "RXN-10659"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == * smiles: ** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10659 RXN-10659] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-(acyl-carrier-pro...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10659 RXN-10659] ==
* smiles:
+
* direction:
** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N
+
 
* common name:
 
* common name:
** N-formylkynurenine
+
** 3-oxoacyl-(acyl-carrier-protein)
* molecular weight:
+
* ec number:
** 236.227   
+
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
 
* Synonym(s):
 
* Synonym(s):
** N-Formyl-L-kynurenine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[ARYLFORMAMIDASE-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[3-oxo-cis-D9-hexadecenoyl-ACPs]][c] '''=>''' 1 [[3-hydroxy-cis-D9-hexaecenoyl-ACPs]][c] '''+''' 1 [[NADP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a 3-oxo-cis-Δ9-hexadecenoyl-[acp][c] '''=>''' 1 a (3R)-3-hydroxy cis Δ9-hexadecenoyl-[acp][c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13083]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_9885]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 1022-31-7
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=3-oxoacyl-(acyl-carrier-protein)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202092 25202092]
+
{{#set: ec number=EC-1.1.1.100}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_13083|Tiso_gene_9885}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58629 58629]
+
{{#set: in pathway=PWY-6282}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology|annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C02700 C02700]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
* HMDB : HMDB60485
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: smiles=[CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])}}
+
{{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N}}
+
{{#set: common name=N-formylkynurenine}}
+
{{#set: molecular weight=236.227    }}
+
{{#set: common name=N-Formyl-L-kynurenine}}
+
{{#set: consumed by=ARYLFORMAMIDASE-RXN}}
+

Latest revision as of 19:58, 21 March 2018

Reaction RXN-10659

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxoacyl-(acyl-carrier-protein)
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6282, palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): PWY-6282
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links