Difference between revisions of "CPD-14704"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11351 RXN-11351] == * direction: ** LEFT-TO-RIGHT * common name: ** beta-lactamase * ec number:...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11351 RXN-11351] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
 
* common name:
 
* common name:
−
** beta-lactamase
+
** 4-hydroxy-2-nonenal-glutathione conjugate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.4.16.4 EC-3.4.16.4]
+
** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 462.537   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2 [[CPD-12310]][c] '''+''' 3 [[WATER]][c] '''=>''' 1 [[UNDECAPRENYL-DIPHOSPHATE]][c] '''+''' 1 [[CPD-12311]][c] '''+''' 4 [[D-ALANINE]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-13673]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 a peptidoglycan dimer (E. faeciums)[c] '''+''' 3 H2O[c] '''=>''' 1 di-trans,octa-cis-undecaprenyl diphosphate[c] '''+''' 1 a peptidoglycan with D,D cross-link (E. faecium)[c] '''+''' 4 D-alanine[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_18870]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6471]], peptidoglycan biosynthesis IV (Enterococcus faecium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6471 PWY-6471]
+
−
** '''3''' reactions found over '''10''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=beta-lactamase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725]
−
{{#set: ec number=EC-3.4.16.4}}
+
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}}
−
{{#set: gene associated=Tiso_gene_18870}}
+
{{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}}
−
{{#set: in pathway=PWY-6471}}
+
{{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=462.537    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: produced by=RXN-13673}}
−
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 19:58, 21 March 2018

Metabolite CPD-14704

  • smiles:
    • CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
  • common name:
    • 4-hydroxy-2-nonenal-glutathione conjugate
  • inchi key:
    • InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
  • molecular weight:
    • 462.537
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-14704&oldid=44988"