Difference between revisions of "Cis-delta15-3-oxo-gheddoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] == * smiles: ** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta15-3-oxo-gheddoyl-ACPs cis-delta15-3-oxo-gheddoyl-ACPs] == * common name: ** a cis-del...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta15-3-oxo-gheddoyl-ACPs cis-delta15-3-oxo-gheddoyl-ACPs] ==
−
* smiles:
+
−
** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C
+
−
* inchi key:
+
−
** InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N
+
 
* common name:
 
* common name:
−
** torulene
+
** a cis-delta15-3-oxo-C34:1-[acp]
−
* molecular weight:
+
−
** 534.867   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3',4'-didehydro-β,ψ-carotene
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11989]]
+
* [[RXN1G-358]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-324]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a cis-delta15-3-oxo-C34:1-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10218186 10218186]
+
{{#set: consumed by=RXN1G-358}}
−
* CHEMSPIDER:
+
{{#set: produced by=RXN1G-324}}
−
** [http://www.chemspider.com/Chemical-Structure.8393678.html 8393678]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9638 9638]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C08613 C08613]
+
−
{{#set: smiles=CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C}}
+
−
{{#set: inchi key=InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N}}
+
−
{{#set: common name=torulene}}
+
−
{{#set: molecular weight=534.867    }}
+
−
{{#set: common name=3',4'-didehydro-β,ψ-carotene}}
+
−
{{#set: consumed by=RXN-11989}}
+

Latest revision as of 20:09, 21 March 2018

Metabolite cis-delta15-3-oxo-gheddoyl-ACPs

  • common name:
    • a cis-delta15-3-oxo-C34:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta15-3-oxo-C34:1-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-delta15-3-oxo-gheddoyl-ACPs&oldid=39834"