Difference between revisions of "BETA-D-XYLOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-OHMYR-ACETYLGLUCOSAMINE UDP-OHMYR-ACETYLGLUCOSAMINE] == * smiles: ** CCCCCCCCCCCC(CC(OC3(C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-XYLOSE BETA-D-XYLOSE] == * smiles: ** C1(OC(O)C(O)C(O)C(O)1) * common name: ** β-D-...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-XYLOSE BETA-D-XYLOSE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(OC(O)C(O)C(O)C(O)1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** β-D-xylopyranose |
+ | * inchi key: | ||
+ | ** InChIKey=SRBFZHDQGSBBOR-KKQCNMDGSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 150.131 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β-D-xylose |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.2.1.37-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=125409 125409] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.111589.html 111589] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28161 28161] |
− | * | + | * METABOLIGHTS : MTBLC28161 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02096 C02096] |
− | {{#set: smiles= | + | {{#set: smiles=C1(OC(O)C(O)C(O)C(O)1)}} |
− | {{#set: | + | {{#set: common name=β-D-xylopyranose}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=SRBFZHDQGSBBOR-KKQCNMDGSA-N}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=150.131 }} |
− | {{#set: common name= | + | {{#set: common name=β-D-xylose}} |
− | + | {{#set: produced by=3.2.1.37-RXN}} | |
− | {{#set: produced by= | + |
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite BETA-D-XYLOSE
- smiles:
- C1(OC(O)C(O)C(O)C(O)1)
- common name:
- β-D-xylopyranose
- inchi key:
- InChIKey=SRBFZHDQGSBBOR-KKQCNMDGSA-N
- molecular weight:
- 150.131
- Synonym(s):
- β-D-xylose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links