Difference between revisions of "Tiso gene 14126"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19202 CPD-19202] == * smiles: ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(N...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14126 == * Synonym(s): == Reactions associated == * Reaction: ALCD19 ** Source: orthology-creinhardtii * Reaction: ALCDH_nadp_hi...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19202 CPD-19202] ==
+
== Gene Tiso_gene_14126 ==
* smiles:
+
** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(NC(CO)C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2))=O)C3(C=CC(O)=CC=3)
+
* inchi key:
+
** InChIKey=ZHBGOAMEFNAJGS-JUCVYKANSA-O
+
* common name:
+
** L-4-hydroxyphenylglycine-L-arginyl-D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine
+
* molecular weight:
+
** 709.734   
+
 
* Synonym(s):
 
* Synonym(s):
** L-pHPG-L-Arg-D-pHPG-L-Ser-L-pHPG
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17832]]
+
* Reaction: [[ALCD19]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-creinhardtii]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[ALCDH_nadp_hi]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ALCDH_nadp_i]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-12484]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(NC(CO)C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2))=O)C3(C=CC(O)=CC=3)}}
+
{{#set: reaction associated=ALCD19|ALCDH_nadp_hi|ALCDH_nadp_i|GLYCEROL-DEHYDROGENASE-NADP+-RXN|RXN-12484}}
{{#set: inchi key=InChIKey=ZHBGOAMEFNAJGS-JUCVYKANSA-O}}
+
{{#set: common name=L-4-hydroxyphenylglycine-L-arginyl-D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine}}
+
{{#set: molecular weight=709.734    }}
+
{{#set: common name=L-pHPG-L-Arg-D-pHPG-L-Ser-L-pHPG}}
+
{{#set: consumed by=RXN-17832}}
+

Latest revision as of 19:59, 21 March 2018

Gene Tiso_gene_14126

  • Synonym(s):

Reactions associated

Pathways associated

External links